|
|
| | Lenalidomide Impurity 3 Basic information |
| Product Name: | Lenalidomide Impurity 3 | | Synonyms: | 2-(4-Amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)pentanedioic acid;2-(4-amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)glutaric acid;Lenalidomide Impurity DA;Pentanedioic acid, 2-(4-amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)- | | CAS: | 295357-66-3 | | MF: | C13H14N2O5 | | MW: | 278.26 | | EINECS: | | | Product Categories: | | | Mol File: | 295357-66-3.mol |  |
| | Lenalidomide Impurity 3 Chemical Properties |
| Boiling point | 617.6±55.0 °C(Predicted) | | density | 1.522±0.06 g/cm3(Predicted) | | pka | 3.51±0.10(Predicted) | | InChI | InChI=1S/C13H14N2O5/c14-9-3-1-2-7-8(9)6-15(12(7)18)10(13(19)20)4-5-11(16)17/h1-3,10H,4-6,14H2,(H,16,17)(H,19,20) | | InChIKey | DVFZIZCDDQITQV-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(N1CC2=C(C1=O)C=CC=C2N)CCC(O)=O |
| | Lenalidomide Impurity 3 Usage And Synthesis |
| | Lenalidomide Impurity 3 Preparation Products And Raw materials |
|