|
|
| | PROMETHAZINE SULFOXIDE Basic information |
| | PROMETHAZINE SULFOXIDE Chemical Properties |
| Boiling point | 461.6±34.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Chloroform, Methanol (Slightly) | | form | Solid | | pka | 8.90±0.50(Predicted) | | color | Light Purple to Purple | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C17H20N2OS/c1-13(18(2)3)12-19-14-8-4-6-10-16(14)21(20)17-11-7-5-9-15(17)19/h4-11,13H,12H2,1-3H3 | | InChIKey | OWTCLFIFAFHQIX-UHFFFAOYSA-N | | SMILES | [S]1(=O)c2c(cccc2)N(c3c1cccc3)CC(N(C)C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | PROMETHAZINE SULFOXIDE Usage And Synthesis |
| Chemical Properties | Dark Pink Solid | | Uses | A metabolite of Promethazine (P757000). | | Definition | ChEBI: Promethazine sulfoxide is a member of phenothiazines. |
| | PROMETHAZINE SULFOXIDE Preparation Products And Raw materials |
|