- Dibutyltin maleate
-
-
2026-02-02
- CAS:78-04-6
- Min. Order: 10mg
- Purity: 99%
- Supply Ability: 2000tons
- Dibutyltin maleate
-
-
2025-06-27
- CAS:78-04-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 500000kg
- Dibutyltin maleate
-
- $30.00
-
2025-06-20
- CAS:78-04-6
- Min. Order: 1kg
- Purity: 0.99
- Supply Ability: 10 tons
|
| | Dibutyltin maleate Basic information |
| Product Name: | Dibutyltin maleate | | Synonyms: | 1,3,2-Dioxastannepin-4,7-dione,2,2-dibutyl-;2-dioxastannepin-4,7-dione,2,2-dibutyl-3;3,2-Dioxastannepin-4,7-dione,2,2-dibutyl-1;advastabdbtm;advastabt290;advastabt340;bt31;dibutylstannylenemaleate | | CAS: | 78-04-6 | | MF: | C12H20O4Sn | | MW: | 346.99 | | EINECS: | 201-077-5 | | Product Categories: | Classes of Metal Compounds;Sn (Tin) Compounds;Typical Metal Compounds;Organometallic Reagents;Organotin;Organotins;Used for plastic heat stabilizer | | Mol File: | 78-04-6.mol |  |
| | Dibutyltin maleate Chemical Properties |
| Melting point | 135-140 °C(lit.) | | Boiling point | 324.1±25.0 °C(Predicted) | | density | 1,318 g/cm3 | | refractive index | 1.502 | | Fp | 204°C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | clear liquid | | Specific Gravity | 1.318 | | color | Light yellow to Yellow to Orange | | Hydrolytic Sensitivity | 2: reacts with aqueous acid | | InChI | InChI=1S/C4H4O4.2C4H9.Sn/c5-3(6)1-2-4(7)8;2*1-3-4-2;/h1-2H,(H,5,6)(H,7,8);2*1,3-4H2,2H3;/q;;;+2/p-2/b2-1-;;; | | InChIKey | ZBBLRPRYYSJUCZ-GRHBHMESSA-L | | SMILES | O1C(=O)C=CC(=O)O[Sn]1(CCCC)CCCC | | CAS DataBase Reference | 78-04-6(CAS DataBase Reference) | | EPA Substance Registry System | Dibutyltin maleate (78-04-6) |
| Hazard Codes | T+,N,T | | Risk Statements | 24/25-26-36/37/38-50/53-68-48/25-43-34-23-22-61-60 | | Safety Statements | 26-28-36/37-45-60-61-36/37/39-22 | | RIDADR | UN 3146 6.1/PG 2 | | WGK Germany | 3 | | RTECS | JH4735000 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III | | HS Code | 29349990 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 4 Oral
Aquatic Chronic 2
Eye Dam. 1
Muta. 2
Repr. 1B
Skin Corr. 1B
Skin Sens. 1
STOT RE 1 | | Toxicity | LDLo oral in mouse: 470mg/kg |
| | Dibutyltin maleate Usage And Synthesis |
| Chemical Properties | White powder. Melting point 108-113°C. Slightly soluble in benzene and toluene, insoluble in water. | | Uses | PVC Stabilizer, condensation catalyst |
| | Dibutyltin maleate Preparation Products And Raw materials |
|