|
|
| | 4-Chlorobenzenesulfonamide Basic information |
| | 4-Chlorobenzenesulfonamide Chemical Properties |
| Melting point | 140-144 °C (lit.) | | Boiling point | 342.2±44.0 °C(Predicted) | | density | 1.408 (estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 9.89±0.10(Predicted) | | form | Powder | | color | White | | Water Solubility | 1.322g/L(15 ºC) | | BRN | 1308891 | | InChI | InChI=1S/C6H6ClNO2S/c7-5-1-3-6(4-2-5)11(8,9)10/h1-4H,(H2,8,9,10) | | InChIKey | HHHDJHHNEURCNV-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=CC=C(Cl)C=C1 | | CAS DataBase Reference | 98-64-6(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenesulfonamide, 4-chloro-(98-64-6) | | EPA Substance Registry System | Benzenesulfonamide, 4-chloro- (98-64-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 2 | | RTECS | DB1400000 | | TSCA | TSCA listed | | HS Code | 29350090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Chlorobenzenesulfonamide Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Anticonvulsant against audiogenic convulsion. | | Definition | ChEBI: 4-chlorobenzenesulfonamide is a sulfonamide. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 7, p. 15, 1942 DOI: 10.1021/jo01195a003 |
| | 4-Chlorobenzenesulfonamide Preparation Products And Raw materials |
|