|
|
| | ETHYL COUMARIN-3-CARBOXYLATE Basic information |
| | ETHYL COUMARIN-3-CARBOXYLATE Chemical Properties |
| Melting point | 92-94 °C (lit.) | | Boiling point | 278.88°C (rough estimate) | | density | 1.1096 (rough estimate) | | refractive index | 1.4270 (estimate) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | powder to crystal | | color | White to Almost white | | λmax | 334nm(CH2Cl2)(lit.) | | BRN | 200147 | | InChI | 1S/C12H10O4/c1-2-15-11(13)9-7-8-5-3-4-6-10(8)16-12(9)14/h3-7H,2H2,1H3 | | InChIKey | XKHPEMKBJGUYCM-UHFFFAOYSA-N | | SMILES | CCOC(=O)C1=Cc2ccccc2OC1=O | | CAS DataBase Reference | 1846-76-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | DJ2501000 | | HazardClass | IRRITANT | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | ETHYL COUMARIN-3-CARBOXYLATE Usage And Synthesis |
| Chemical Properties | slightly yellow crystalline powder | | Uses | Ethyl 3-coumarincarboxylate is a coumarin derivative. Ethyl 3-coumarincarboxylate can be used as a pseudo-template to give a molecularly imprinted polymer (MIP) that has a fairly specific recognition capability for aflatoxins[1]. | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 3, p. 165, 1955
The Journal of Organic Chemistry, 49, p. 5195, 1984 DOI: 10.1021/jo00200a036 | | References | [1] Wu C, et al. Solid-phase extraction of aflatoxins using a nanosorbent consisting of a magnetized nanoporous carbon core coated with a molecularly imprinted polymer. Mikrochim Acta. 2018 Oct 25;185(11):515. DOI:10.1007/s00604-018-3051-8 |
| | ETHYL COUMARIN-3-CARBOXYLATE Preparation Products And Raw materials |
|