|
|
| | 2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID Basic information |
| Product Name: | 2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID | | Synonyms: | 2,4,5-TRIFLUORO-M-ANISIC ACID;3-Methoxy-2,4,5-Trifluorobenzoic Acid 2,4,5-Trifluoro-3-Methoxybenzoic Acid;3-METHOXY-2,4,5-TRIFLUOROBENZOID ACID;3-Methoxy-2,4,5-trifluorobenzoic acid,97%;3-Methoxy-2,4,5-trif;3-Methoxy-2;A190 3-Methoxy-2,4,5-trifluorobenzoic acid;2,4,5-tifluoro-3-Methoxybenzoicacid | | CAS: | 11281-65-5 | | MF: | C8H5F3O3 | | MW: | 206.12 | | EINECS: | | | Product Categories: | Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzoic acid;OLED | | Mol File: | 11281-65-5.mol |  |
| | 2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID Chemical Properties |
| Melting point | 105-112 °C(lit.) | | Boiling point | 203°C (rough estimate) | | density | 1.4251 (estimate) | | form | Powder | | color | White | | InChI | InChI=1S/C8H5F3O3/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11/h2H,1H3,(H,12,13) | | InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N | | SMILES | C1(OC)=C(F)C(=CC(C(=O)O)=C1F)F | | CAS DataBase Reference | 11281-65-5(CAS DataBase Reference) |
| | 2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder |
| | 2,4,5-TRIFLUORO-3-METHOXYBENZOIC ACID Preparation Products And Raw materials |
|