|
|
| | 2,3,5-TRI-O-BENZYL-BETA-D-ARABINOFURANOSE Basic information |
| Product Name: | 2,3,5-TRI-O-BENZYL-BETA-D-ARABINOFURANOSE | | Synonyms: | 2,3,5-TRI-O-BENZYL-B-D-ARABINOFURANOSE;2,3,5-TRI-O-BENZYL-BETA-D-ARABINOFURANOSE;2,3,5-Tris-O-(phenylmethyl)-beta-D-arabinofuranose;2,3,5-Tri-O-benzoyl-beta-D-arabinofuranose;3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)oxolan-2-ol;2,3,5-Tri-O-benzyl-;2,3,5-Tri-O-benzyl-β-D-arabinofuranose ,99%;3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2-oxolanol | | CAS: | 60933-68-8 | | MF: | C26H28O5 | | MW: | 420.5 | | EINECS: | | | Product Categories: | | | Mol File: | 60933-68-8.mol |  |
| | 2,3,5-TRI-O-BENZYL-BETA-D-ARABINOFURANOSE Chemical Properties |
| Boiling point | 570.5±50.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | Soluble in methanol | | form | Powder | | pka | 11.95±0.70(Predicted) | | color | White to Off-white | | InChI | InChI=1/C26H28O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24-,25+,26-/s3 | | InChIKey | NAQUAXSCBJPECG-BTUDYTORSA-N | | SMILES | [C@@H]1(OCC2=CC=CC=C2)[C@@H](COCC2C=CC=CC=2)O[C@@H](O)[C@H]1OCC1C=CC=CC=1 |&1:0,9,20,22,r| | | CAS DataBase Reference | 60933-68-8(CAS DataBase Reference) |
| | 2,3,5-TRI-O-BENZYL-BETA-D-ARABINOFURANOSE Usage And Synthesis |
| Chemical Properties | White to off-white crystal | | Uses | An arabinofuranose derivative. |
| | 2,3,5-TRI-O-BENZYL-BETA-D-ARABINOFURANOSE Preparation Products And Raw materials |
|