|
|
| | 4-Bromo-2-methyl-6-nitroaniline Basic information |
| | 4-Bromo-2-methyl-6-nitroaniline Chemical Properties |
| Melting point | 143-147 °C | | Boiling point | 326.8±37.0 °C(Predicted) | | density | 1.7207 (rough estimate) | | refractive index | 1.5150 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | powder to crystal | | pka | -1.23±0.25(Predicted) | | color | Light yellow to Brown | | Water Solubility | Slightly soluble in water and soluble in hot methanol. | | BRN | 3530524 | | InChI | InChI=1S/C7H7BrN2O2/c1-4-2-5(8)3-6(7(4)9)10(11)12/h2-3H,9H2,1H3 | | InChIKey | ZXFVKFUXKFPUQJ-UHFFFAOYSA-N | | SMILES | C1(N)=C([N+]([O-])=O)C=C(Br)C=C1C | | CAS DataBase Reference | 77811-44-0(CAS DataBase Reference) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36/37 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HS Code | 29214200 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Bromo-2-methyl-6-nitroaniline Usage And Synthesis |
| Chemical Properties | orange to orange-brown glistening crystals | | Uses | It is used in the design and synthesis of CK2 inhibitors and in the docking studies of novel telmisartan-glitazone hybrid analogs for the treatment of metabolic syndrome. |
| | 4-Bromo-2-methyl-6-nitroaniline Preparation Products And Raw materials |
|