|
|
| | 1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE Basic information |
| Product Name: | 1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE | | Synonyms: | 1,3,5-Triazine, 1,3,5-tributylhexahydro-;1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE 98+%;1,3,5-Tributylhexahydro-s-triazine;1,3,5-Tributylhexahydro-1,3,5-trizine;1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE;1,3,5-TRI-N-BUTYLHEXAHYDRO-S-TRIAZINE;1,3,5-tributyl-1,3,5-triazinane | | CAS: | 13036-83-4 | | MF: | C15H33N3 | | MW: | 255.44 | | EINECS: | 235-905-1 | | Product Categories: | | | Mol File: | 13036-83-4.mol |  |
| | 1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE Chemical Properties |
| Boiling point | 285℃ | | density | 0.876±0.06 g/cm3 (20 ºC 760 Torr) | | refractive index | 1.4575 (20℃) | | Fp | 124.3±10.3℃ | | pka | 6.71±0.20(Predicted) | | InChI | InChI=1S/C15H33N3/c1-4-7-10-16-13-17(11-8-5-2)15-18(14-16)12-9-6-3/h4-15H2,1-3H3 | | InChIKey | OIQDTXAPPNRLAS-UHFFFAOYSA-N | | SMILES | N1(CCCC)CN(CCCC)CN(CCCC)C1 | | EPA Substance Registry System | 1,3,5-Triazine, 1,3,5-tributylhexahydro- (13036-83-4) |
| | 1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE Usage And Synthesis |
| | 1,3,5-TRIBUTYLHEXAHYDRO-1,3,5-TRIAZINE Preparation Products And Raw materials |
|