2-AMINO-5-BROMO-3-FLUORO-BENZONITRILE manufacturers
|
| | 2-AMINO-5-BROMO-3-FLUORO-BENZONITRILE Basic information |
| | 2-AMINO-5-BROMO-3-FLUORO-BENZONITRILE Chemical Properties |
| Boiling point | 265.5±40.0 °C(Predicted) | | density | 1.77±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | -0.29±0.10(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C7H4BrFN2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-2H,11H2 | | InChIKey | SRNMCPRKRDYFPG-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(Br)=CC(F)=C1N |
| | 2-AMINO-5-BROMO-3-FLUORO-BENZONITRILE Usage And Synthesis |
| Synthesis | Take 2-amino-5-fluorobenzoic acid as raw material, through bromination, diazotization, reduction synthesis of intermediate 3-bromo-5-fluorobenzoic acid, then toluene as a solvent, chlorosulfoxide chlorination after the passage of ammonia, the result of the amide and phosphorus pentoxide coheated distillation can be obtained 2-amino-5-bromo-3-fluorobenzonitrile, the total yield of 53.4% (as 2-amino-5-fluorobenzoic acid). |
| | 2-AMINO-5-BROMO-3-FLUORO-BENZONITRILE Preparation Products And Raw materials |
|