| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:4-AMinophenol-d7
CAS:285132-88-9
Remarks:CS-C-00359
|
|
| | 4-AMINOPHENOL-D7 Basic information |
| | 4-AMINOPHENOL-D7 Chemical Properties |
| Melting point | 188-190 °C (lit.) | | Fp | 195℃ | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | color | Brown to Very Dark Brown | | InChI | 1S/C6H7NO/c7-5-1-3-6(8)4-2-5/h1-4,8H,7H2/i1D,2D,3D,4D/hD3 | | InChIKey | PLIKAWJENQZMHA-ZZLZVNDKSA-N | | SMILES | [2H]Oc1c([2H])c([2H])c(N([2H])[2H])c([2H])c1[2H] | | CAS Number Unlabeled | 123-30-8 |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-36/37/38-40-42/43-68-50/53-20/22 | | Safety Statements | 22-26-36-61-60-36/37-28 | | RIDADR | UN 2512 6.1/PG 3 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Muta. 2 |
| | 4-AMINOPHENOL-D7 Usage And Synthesis |
| Uses | 4-Aminophenol-d7 is a reagent used in the synthesis of labeled ambroxol and its major metabolites. |
| | 4-AMINOPHENOL-D7 Preparation Products And Raw materials |
|