| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Ethyl 2-propylacrylate
CAS:3550-06-9
Purity:99%, contains 150 ppm BHT as inhibitor Package:250MG Remarks:590118-250MG
|
| Company Name: |
Chengdu Kamel Pharmaceutical Co., Ltd
|
| Tel: |
028-67136579 15828051124 |
| Email: |
sales@kamelpharm.com |
| Products Intro: |
Product Name:ethyl 2-propylacrylate
CAS:3550-06-9
Purity:98% Package:1g;10g;1kg Remarks:002626
|
ETHYL 2-PROPYLACRYLATE 99 manufacturers
|
| | ETHYL 2-PROPYLACRYLATE 99 Basic information |
| | ETHYL 2-PROPYLACRYLATE 99 Chemical Properties |
| Boiling point | 141 °C (lit.) | | density | 0.880 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.4234(lit.) | | Fp | 115 °F | | storage temp. | 2-8°C | | InChI | 1S/C8H14O2/c1-4-6-7(3)8(9)10-5-2/h3-6H2,1-2H3 | | InChIKey | MXUMJFMINXROCH-UHFFFAOYSA-N | | SMILES | [H]\C([H])=C(/CCC)C(=O)OCC |
| Hazard Codes | Xn | | Risk Statements | 10-36/37/38-42/43 | | Safety Statements | 23-26-36/37/39-45 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 1 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Irrit. 2
Flam. Liq. 3
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | ETHYL 2-PROPYLACRYLATE 99 Usage And Synthesis |
| | ETHYL 2-PROPYLACRYLATE 99 Preparation Products And Raw materials |
|