| Company Name: |
Sichuan Kulinan Technology Co., Ltd
|
| Tel: |
400-1166-196 18981987031 |
| Email: |
cdhxsj@163.com |
| Products Intro: |
Product Name:FLUAZIFOP-METHYL
CAS:69335-90-6
Purity:99% HPLC Package:10g;50g;100g;500g;1kg;5kg;25kg
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Fluazifop-methyl
CAS:69335-90-6
Purity:99% Package:10mg,100mg
|
| Company Name: |
Codow Chemical Co.,Ltd.
|
| Tel: |
18620099427 |
| Email: |
amy@howeipharm.com |
| Products Intro: |
Product Name:Fluazifop-methyl
CAS:69335-90-6
Package:2.5MG;5MG;10MG;25MG;100MG
|
|
| | FLUAZIFOP-METHYL Basic information |
| Product Name: | FLUAZIFOP-METHYL | | Synonyms: | Fluazifop-methyl PESTANAL;Methyl 2-[4-(5-trifluoromethyl-2-pyridyloxy)phenoxy]propionate;2-[4-[[5-(Trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic acid methyl ester;Fluazifop methyl ester;2-[4-(5-trifluoromethylpyridin-2-yloxy)-phenoxy]-propionic acid methyl ester;IAUMNRCGDHLAMJ-UHFFFAOYSA-N;Fluazifop-P-methyl;Propanoic acid, 2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]phenoxy]-, methyl ester | | CAS: | 69335-90-6 | | MF: | C16H14F3NO4 | | MW: | 341.28 | | EINECS: | | | Product Categories: | | | Mol File: | 69335-90-6.mol |  |
| | FLUAZIFOP-METHYL Chemical Properties |
| Melting point | 75-80 °C | | storage temp. | 2-8°C | | solubility | soluble in Dichloromethane, Diethyl Ether, Ethyl Acetate | | InChI | 1S/C16H14F3NO4/c1-10(15(21)22-2)23-12-4-6-13(7-5-12)24-14-8-3-11(9-20-14)16(17,18)19/h3-10H,1-2H3 | | InChIKey | IAUMNRCGDHLAMJ-UHFFFAOYSA-N | | SMILES | COC(=O)C(C)Oc1ccc(Oc2ccc(cn2)C(F)(F)F)cc1 |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 61 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FLUAZIFOP-METHYL Usage And Synthesis |
| Uses | Fluazifop-methyl is an intermediate in the synthesis of (┬)-Fluazifop (F407430). (┬)-Fluazifop is a grass-selective herbicide which inhibits acetyl-CoA carboxylase in sensitive plant species. |
| | FLUAZIFOP-METHYL Preparation Products And Raw materials |
|