| Company Name: |
Jointpharma Technology Co.Ltd Gold
|
| Tel: |
021-61150629 15921749159 |
| Email: |
0235@jointpharma.cn |
| Products Intro: |
Product Name:tert-Butyl 7-hydroxy-4-azaspiro[2.5]octane-4-carboxylate CAS:2306269-68-9 Purity:97% Package:1g;5g;10g
|
| Company Name: |
PharmaBlock Sciences (Nanjing),Inc.
|
| Tel: |
025-86918202 4000255188 |
| Email: |
sales@pharmablock.com |
| Products Intro: |
Product Name:tert-butyl 7-hydroxy-4-azaspiro[2.5]octane-4-carboxylate CAS:2306269-68-9 Purity:97 Package:100MG;250MG;1G;5G
|
|
| | 4-Azaspiro[2.5]octane-4-carboxylic acid, 7-hydroxy-, 1,1-dimethylethyl ester Basic information |
| | 4-Azaspiro[2.5]octane-4-carboxylic acid, 7-hydroxy-, 1,1-dimethylethyl ester Chemical Properties |
| InChI | InChI=1S/C12H21NO3/c1-11(2,3)16-10(15)13-7-4-9(14)8-12(13)5-6-12/h9,14H,4-8H2,1-3H3 | | InChIKey | VMNNSPNZFMIABL-UHFFFAOYSA-N | | SMILES | C1C2(CC(O)CCN2C(OC(C)(C)C)=O)C1 |
| | 4-Azaspiro[2.5]octane-4-carboxylic acid, 7-hydroxy-, 1,1-dimethylethyl ester Usage And Synthesis |
| | 4-Azaspiro[2.5]octane-4-carboxylic acid, 7-hydroxy-, 1,1-dimethylethyl ester Preparation Products And Raw materials |
|