|
|
| Product Name: | SB 4 | | Synonyms: | BMP signaling agonist sb4;SB 4;Benzoxazole, 2-[[(4-bromophenyl)methyl]thio]-;SB 4 (Eticovo);2-((4-Bromobenzyl)thio)benzo[d]oxazole;Inhibitor,SMAD,bmp,cell,inhibit,BMP signaling agonist sb4,BRE-luc,BMP signaling agonist sb 4,Transforming growth factor beta receptors,PREC,BMP signaling agonist sb-4,agonist,TGF-β Receptor;BMP signaling agonist sb4, 10 mM in DMSO;SB 4 ，S0523 | | CAS: | 100874-08-6 | | MF: | C14H10BrNOS | | MW: | 320.2 | | EINECS: | | | Product Categories: | | | Mol File: | 100874-08-6.mol |  |
| Melting point | 70-72 °C | | Boiling point | 444.2±47.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Soluble in DMSO | | form | Solid | | pka | 0.92±0.10(Predicted) | | color | White to light yellow | | InChI | 1S/C14H10BrNOS/c15-11-7-5-10(6-8-11)9-18-14-16-12-3-1-2-4-13(12)17-14/h1-8H,9H2 | | InChIKey | JDVOIBFEFVKUPL-UHFFFAOYSA-N | | SMILES | BrC1=CC=C(CSC2=NC3=C(C=CC=C3)O2)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| Uses | SB 4 (Eticovo) is a potent and selective agonist of bone morphogenetic protein 4 (BMP4) signaling. | | Biological Activity | Sb4 is a cell penetrant, potent bone morphogenetic protein (BMP) signaling agonist th at rapidly activate BMP in human renal cells (HEK293). Sb4 activates BMP by stabilization of intracellular p-SMAD-1/5/9. Apparently activation of the BMP pathway by sb4 cannot be reversed by inhibition of Noggin or type I BMP kinase inhibitors | | storage | Store at -20°C |
| | SB 4 Preparation Products And Raw materials |
|