| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:5-(4-Methoxyphenyl)-2-furancarboxaldehyde CAS:34070-33-2 Purity:95% Package:500Mg,5g
|
5-(4-METHOXY-PHENYL)-FURAN-2-CARBALDEHYDE manufacturers
|
| | 5-(4-METHOXY-PHENYL)-FURAN-2-CARBALDEHYDE Basic information |
| Product Name: | 5-(4-METHOXY-PHENYL)-FURAN-2-CARBALDEHYDE | | Synonyms: | OTAVA-BB 1148436;5-(4-methoxyphenyl)-2-furaldehyde(SALTDATA: FREE);5-(4-Methoxyphenyl)-2-furancarboxaldehyde;5-(4-Methoxyphenyl)furfural;5-(p-Methoxyphenyl)-2-furaldehyde;5-(p-Methoxyphenyl)-2-furancarboxaldehyde;5-p-Anisylfurfural;CHEMBRDG-BB 4003571 | | CAS: | 34070-33-2 | | MF: | C12H10O3 | | MW: | 202.21 | | EINECS: | | | Product Categories: | | | Mol File: | 34070-33-2.mol |  |
| | 5-(4-METHOXY-PHENYL)-FURAN-2-CARBALDEHYDE Chemical Properties |
| Melting point | 42-42.5℃ | | Boiling point | 166 °C(Press: 1 Torr) | | density | 1.167±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Heated), Chloroform, Methanol (Slightly) | | form | Orange to Dark Red Semi-Solid | | InChI | 1S/C12H10O3/c1-14-10-4-2-9(3-5-10)12-7-6-11(8-13)15-12/h2-8H,1H3 | | InChIKey | JPCUGGGXLKGQEP-UHFFFAOYSA-N | | SMILES | COc1ccc(cc1)-c2ccc(C=O)o2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-(4-METHOXY-PHENYL)-FURAN-2-CARBALDEHYDE Usage And Synthesis |
| Uses | 5-(4-Methoxyphenyl)-2-furancarboxaldehyde is an intermediate in the synthesis of near-IR fluorescent dyes. |
| | 5-(4-METHOXY-PHENYL)-FURAN-2-CARBALDEHYDE Preparation Products And Raw materials |
|