- CHLOROMETHYL BUTYRATE
-
- $1.00
-
2019-07-06
- CAS:33657-49-7
- Min. Order: 1kg
- Purity: as customer's need
- Supply Ability: 1000kg
|
| | Chloromethyl butyrate Basic information |
| Product Name: | Chloromethyl butyrate | | Synonyms: | ChloroMethyl butyrate, 99% 25GR;ChloroMethyl butyrate, 98.5%;Butanoic acid,chloroMethyl ester;CHLOROMETHYL BUTYRATE;Chloromethyl butyrate,99%;Chloromethyl butanoate2009;5-chloropentanoate;chloromethyl n-butyrate | | CAS: | 33657-49-7 | | MF: | C5H9ClO2 | | MW: | 136.58 | | EINECS: | | | Product Categories: | K00001 | | Mol File: | 33657-49-7.mol |  |
| | Chloromethyl butyrate Chemical Properties |
| Boiling point | 150 °C (744.8493 mmHg) | | density | 1.074 | | refractive index | 1.419-1.421 | | Fp | 55 °C | | storage temp. | Storage temp. 2-8°C | | form | Liquid | | color | Clear colorless | | InChI | InChI=1S/C5H9ClO2/c1-2-3-5(7)8-4-6/h2-4H2,1H3 | | InChIKey | BDPZFQLKFUONAG-UHFFFAOYSA-N | | SMILES | C(OCCl)(=O)CCC |
| Hazard Codes | C | | Risk Statements | 34-10 | | Safety Statements | 45-36/37/39-26-16 | | RIDADR | 2924 | | HazardClass | 3/8 | | PackingGroup | III | | HS Code | 29156000 |
| Provider | Language |
|
ACROS
| English |
| | Chloromethyl butyrate Usage And Synthesis |
| Chemical Properties | Colorless to Almost colorless clear liquid. | | Uses | clevidipine incorporates a methoxymethyl ester, a function that is readily cleaved to the corresponding acid by serum esterases. The actual experimental details in patents describe the preparation of this compound by simple alkylation of the monoester with chloromethyl butyrate. |
| | Chloromethyl butyrate Preparation Products And Raw materials |
|