|
|
| | 4-OCTANOL Basic information |
| | 4-OCTANOL Chemical Properties |
| Melting point | 41°C | | Boiling point | 174-176 °C (lit.) | | density | 0.818 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.426 | | Fp | 65°C | | storage temp. | Store at room temperature | | pka | 15.31±0.20(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 1719296 | | Henry's Law Constant | 1.3×10-1 mol/(m3Pa) at 25℃, Gharagheizi et al. (2012) | | Dielectric constant | 5.1200000000000001 | | InChI | InChI=1S/C8H18O/c1-3-5-7-8(9)6-4-2/h8-9H,3-7H2,1-2H3 | | InChIKey | WOFPPJOZXUTRAU-UHFFFAOYSA-N | | SMILES | C(O)(CCC)CCCC | | LogP | 2.680 |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36-24/25 | | WGK Germany | 3 | | HS Code | 29051685 | | Storage Class | 10 - Combustible liquids |
| | 4-OCTANOL Usage And Synthesis |
| Chemical Properties | Clear colorless liquid |
| | 4-OCTANOL Preparation Products And Raw materials |
|