- Zinc undecylenate
-
- $5.00
-
2026-05-28
- CAS:557-08-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10000kg
|
| | Zinc undecylenate Basic information |
| | Zinc undecylenate Chemical Properties |
| Melting point | 118-121 °C (lit.) | | vapor density | 14.9 (vs air) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Practically insoluble in water and in ethanol (96 per cent). | | form | Solid | | color | White to Off-White | | Specific Gravity | 1.1 | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | Merck | 13,9916 | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | ANTIMICROBIAL ANTICAKING OPACIFYING | | InChI | InChI=1S/2C11H20O2.Zn/c2*1-2-3-4-5-6-7-8-9-10-11(12)13;/h2*2H,1,3-10H2,(H,12,13);/q;;+2/p-2 | | InChIKey | YMCOHQVWOBMDCZ-UHFFFAOYSA-L | | SMILES | O([Zn]OC(=O)CCCCCCCCC=C)C(=O)CCCCCCCCC=C | | LogP | 3.987 (est) | | CAS DataBase Reference | 557-08-4(CAS DataBase Reference) | | EPA Substance Registry System | 10-Undecenoic acid, zinc salt (557-08-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39-36 | | RIDADR | UN3077 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 9 | | Storage Class | 11 - Combustible Solids |
| | Zinc undecylenate Usage And Synthesis |
| Chemical Properties | White, amorphous powder. Nearly insoluble in water and alcohol. Combustible. | | Uses | anthelmintic | | Uses | Zinc Undecylenate is an antifungal agent used in ointments that treat athletes foot and other foot dermatophytosis. | | Definition | ChEBI: Zinc undecylenate is a medium-chain fatty acid. | | reaction suitability | core: zinc reagent type: catalyst | | in vivo | 10-Undecenoic acid zinc salt (arginine undecylenate (GS-1) form, 157.6 mg/mL; topical administration; twice a day; 6 days) effectively clears MRSA infections in the epidermal and dermal layers in a rat model of MRSA skin infection[8].
| | IC 50 | Microbial Metabolite; Human Endogenous Metabolite |
| | Zinc undecylenate Preparation Products And Raw materials |
|