11TR-EICOSENOIC ACID manufacturers
- 11TR-EICOSENOIC ACID
-
- $1.00
-
2020-01-13
- CAS:62322-84-3
- Min. Order: 1KG
- Purity: 85.0-99.8%
- Supply Ability: 200kgs
|
| | 11TR-EICOSENOIC ACID Basic information |
| | 11TR-EICOSENOIC ACID Chemical Properties |
| Melting point | 52-53℃ | | Boiling point | 426.3±14.0 °C(Predicted) | | density | 0.895±0.06 g/cm3(Predicted) | | Fp | 110 °C | | storage temp. | -20°C | | solubility | Ethanol: 20 mg/ml; Ethanol:PBS(pH 7.2) (1:1): 0.5 mg/ml | | pka | 4.78±0.10(Predicted) | | form | Solid | | color | White to off-white | | BRN | 1727314 | | InChI | 1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H,21,22)/b10-9+ | | InChIKey | BITHHVVYSMSWAG-MDZDMXLPSA-N | | SMILES | CCCCCCCC\C=C\CCCCCCCCCC(O)=O | | LogP | 8.440 (est) |
| WGK Germany | 3 | | F | 8-10 | | Storage Class | 11 - Combustible Solids |
| | 11TR-EICOSENOIC ACID Usage And Synthesis |
| Uses | (11E)-11-Eicosenoic Acid, is a 20 carbon fatty acid which is used to study phospholipid membranes. It has also shown to be able to inhibit glycerophosphate acyltransferase, cholinephosphotransferase and ethanolaminephosphotransferase in V79-R cells. | | Definition | ChEBI: Trans-gondoic acid is a long-chain fatty acid. |
| | 11TR-EICOSENOIC ACID Preparation Products And Raw materials |
|