| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Email: |
3983243027@qq.com |
| Products Intro: |
Product Name:Ethanone, 1-(8-bromo-2-quinolinyl)- CAS:1355018-24-4 Purity:97%
|
| Company Name: |
Amel Pharmatech Corporation
|
| Tel: |
027-888-4366503 |
| Email: |
sales@amelpharmatech.com |
| Products Intro: |
Product Name:Ethanone, 1-(8-bromo-2-quinolinyl)- CAS:1355018-24-4 Purity:97% Package:g; kg
|
|
| | Ethanone, 1-(8-bromo-2-quinolinyl)- Basic information |
| | Ethanone, 1-(8-bromo-2-quinolinyl)- Chemical Properties |
| Boiling point | 351.4±22.0 °C(Predicted) | | density | 1.520±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | -0.21±0.50(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C11H8BrNO/c1-7(14)10-6-5-8-3-2-4-9(12)11(8)13-10/h2-6H,1H3 | | InChIKey | RFRRSHWJBPVXBR-UHFFFAOYSA-N | | SMILES | C(=O)(C1C=CC2C(N=1)=C(Br)C=CC=2)C |
| | Ethanone, 1-(8-bromo-2-quinolinyl)- Usage And Synthesis |
| | Ethanone, 1-(8-bromo-2-quinolinyl)- Preparation Products And Raw materials |
|