|
|
| | N-METHYL-N-1-NAPHTHYLAMINE Basic information |
| | N-METHYL-N-1-NAPHTHYLAMINE Chemical Properties |
| Melting point | 174°C | | Boiling point | 271.88°C (rough estimate) | | density | 1.0595 (rough estimate) | | refractive index | 1.6722 (estimate) | | storage temp. | 2-8°C(protect from light) | | pka | 3.67(at 27℃) | | Appearance | Light brown to brown Liquid | | InChI | InChI=1S/C11H11N/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-8,12H,1H3 | | InChIKey | AKEYUWUEAXIBTF-UHFFFAOYSA-N | | SMILES | C1(NC)=C2C(C=CC=C2)=CC=C1 | | EPA Substance Registry System | 1-Naphthalenamine, N-methyl- (2216-68-4) |
| TSCA | TSCA listed | | HS Code | 2921490090 |
| | N-METHYL-N-1-NAPHTHYLAMINE Usage And Synthesis |
| | N-METHYL-N-1-NAPHTHYLAMINE Preparation Products And Raw materials |
|