5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE manufacturers
|
| | 5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE Basic information |
| Product Name: | 5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE | | Synonyms: | 5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE;5-METHOXY-4-AZAINDOLE;5-Methoxypyrrolo[3,2-b]pyridine;5-Methoxy-4-azaindole,5-Methoxy-1H-pyrrolo[3,2-b]pyridine;1H-Pyrrolo[3,2-b]pyridine, 5-Methoxy-;5-Metho×y-4-azaindole,5-Metho×y-1H-pyrrolo[3,2-b]pyridine;5-Methoxy-1H-pyrrolo[3;5-Methoxy-1H-pyrrolo[3,2-b]pyridine 97% | | CAS: | 17288-40-3 | | MF: | C8H8N2O | | MW: | 148.16 | | EINECS: | | | Product Categories: | Heterocycle-Pyridine series | | Mol File: | 17288-40-3.mol | ![5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE Structure](CAS/GIF/17288-40-3.gif) |
| | 5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE Chemical Properties |
| Melting point | 115-116°C | | Boiling point | 285℃ | | density | 1.244 | | Fp | 98℃ | | storage temp. | 2-8°C | | form | solid | | pka | 14.36±0.40(Predicted) | | color | Light yellow to brown | | InChI | InChI=1S/C8H8N2O/c1-11-8-3-2-6-7(10-8)4-5-9-6/h2-5,9H,1H3 | | InChIKey | WTIFEVSWZUSXQL-UHFFFAOYSA-N | | SMILES | C12C=CNC1=CC=C(OC)N=2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22-41 | | Safety Statements | 26-39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE Usage And Synthesis |
| Synthesis | GENERAL METHOD: 6-methoxy-3-nitropyridine-2-acetonitrile derivative 13a or 13b (12.9 mmol) was dissolved in ethanol or methanol (40 mL) and a catalytic amount of 10% palladium carbon was added. The reaction mixture was placed in a Paar hydrogenation unit and hydrogenated at room temperature for 24 hours. Upon completion of the reaction, the catalyst was removed by filtration and the solvent was removed by concentration under reduced pressure. The resulting residue was purified by column chromatography with the eluent dichloromethane/ethyl acetate (95/5 for compound 14a) or (6/4 for compound 14b). | | References | [1] Heterocycles, 1999, vol. 50, # 2, p. 1065 - 1080 [2] Current Medicinal Chemistry, 2014, vol. 21, # 14, p. 1654 - 1666 [3] Liebigs Annalen der Chemie, 1988, p. 203 - 208 [4] European Journal of Medicinal Chemistry, 2004, vol. 39, # 6, p. 515 - 526 [5] Patent: US2009/298820, 2009, A1. Location in patent: Page/Page column 36 |
| | 5-METHOXY-1H-PYRROLO[3,2-B]PYRIDINE Preparation Products And Raw materials |
|