|
|
| | (7Z,9E)-dodeca-7,9-dienyl acetate Basic information |
| Product Name: | (7Z,9E)-dodeca-7,9-dienyl acetate | | Synonyms: | (7Z,9E)-dodeca-7,9-dienyl acetate;cis,trans-7,9-dodecadienylacetate;(7E,9Z)-7,9-Dodecadien-1-ol acetate;7,9-Dodecadien-1-ol, 1-acetate, (7E,9Z)-;7,9-Dodecadien-1-ol, acetate, (7E,9Z)-;7,9-Dodecadien-1-ol, acetate, (Z,E)-;Ai3-36734;Ccris 9116 | | CAS: | 54364-62-4 | | MF: | C14H24O2 | | MW: | 224.34 | | EINECS: | 259-127-7 | | Product Categories: | | | Mol File: | 54364-62-4.mol |  |
| | (7Z,9E)-dodeca-7,9-dienyl acetate Chemical Properties |
| Boiling point | 112-118℃ (3 Torr) | | density | 0.896±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | Henry's Law Constant | 1.2×10-2 mol/(m3Pa) at 25℃, Ebert et al. (2023) | | InChI | InChI=1S/C14H24O2/c1-3-4-5-6-7-8-9-10-11-12-13-16-14(2)15/h4-7H,3,8-13H2,1-2H3/b5-4-,7-6+ | | InChIKey | LLRZUAWETKPZJO-SCFJQAPRSA-N | | SMILES | C(OC(=O)C)CCCCC/C=C/C=C\CC | | EPA Substance Registry System | 7,9-Dodecadien-1-ol, acetate, (7E,9Z)- (54364-62-4) |
| | (7Z,9E)-dodeca-7,9-dienyl acetate Usage And Synthesis |
| Uses | (7E,9Z)-7,9-Dodecadien-1-ol, 1-Acetate is a sex pheromone of bud borer Crocidosema Aporema. It is also used in the study of the effect of sex pheromone emission on the attraction of Lobesia Botrana. | | Synthesis Reference(s) | Tetrahedron Letters, 29, p. 217, 1988 DOI: 10.1016/S0040-4039(00)80057-X |
| | (7Z,9E)-dodeca-7,9-dienyl acetate Preparation Products And Raw materials |
| Raw materials | 2-Nonenal, 9-(acetyloxy)-, (E)--->1,3-Hexadiene, (3Z)--->7,9-Dodecadien-1-ol-->(E,E)-7,9-Dodecadienyl acetate-->(7Z,9Z)-7,9-Dodecadien-1-ol acetate-->(7E,9Z)-7,9-Dodecadien-1-ol-->Allyltriphenylphosphonium bromide-->(7Z,9E)-dodecadienyl acetate-->Triphenyl(propyl)phosphonium bromide-->ACETIC ACID 7-OCTEN-1-YL ESTER-->2-[(5-Chloropentyl)oxy]tetrahydro-2H-pyran-->2-Picoline-->Acetic anhydride-->1-BUTENE |
|