- alpha-carboline
-
-
2025-04-04
- CAS:244-76-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
|
| | alpha-carboline Basic information |
| | alpha-carboline Chemical Properties |
| Melting point | 210-212°C | | Boiling point | 373℃ | | density | 1.301 | | Fp | 172℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Acetone, DMSO, Methanol (Slightly, Hetaed) | | form | Solid | | pka | 14.53±0.30(Predicted) | | color | Pale Brown | | λmax | 338nm(CH3CN)(lit.) | | InChI | InChI=1S/C11H8N2/c1-2-6-10-8(4-1)9-5-3-7-12-11(9)13-10/h1-7H,(H,12,13) | | InChIKey | BPMFPOGUJAAYHL-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2=CC=CN=C12 |
| | alpha-carboline Usage And Synthesis |
| Chemical Properties | Light Brown Solid | | Uses | A carcinogenic compound formed during cooking processes | | Definition | ChEBI: 9H-Pyrido[2,3-b]indole is a pyridoindole. | | Synthesis | The 9H-pyrido[2,3- b]indoles were produced by dissolving 1-bromo-2-(2,2-dibromovinyl)benzene or its derivatives, ammonia and a, -unsaturated aldehydes in an organic solvent, and then adding a catalyst, transition metal salts and additives, and then reacting at 60-100 C in the presence of air. The synthesis process of the present invention is a one-pot multi-component tandem reaction, which is simple and easy to operate, and avoids the waste of resources and environmental pollution caused by the use of a variety of reagents and the purification of intermediates in each step of the reaction, and provides an economical and practical method for the synthesis of 9H-pyrido[2,3-b]indole compounds in a green and environmentally friendly way. |
| | alpha-carboline Preparation Products And Raw materials |
|