|
|
| | D-Glucuronic acid 2-propen-1-yl ester Basic information |
| | D-Glucuronic acid 2-propen-1-yl ester Chemical Properties |
| Melting point | 126-128°C | | Boiling point | 493℃ | | density | 1.423 | | Fp | 197℃ | | storage temp. | -86°C Freezer, Under Inert Atmosphere | | solubility | Acetonitrile (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 12.07±0.20(Predicted) | | form | Solid | | color | White to Pale Beige | | Stability: | Light Sensitive, Temperature Sensitive | | InChI | InChI=1S/C9H14O7/c1-2-3-16-9(15)8(14)7(13)6(12)5(11)4-10/h2,4-8,11-14H,1,3H2/t5-,6+,7-,8-/m0/s1 | | InChIKey | YQUWEXFYFCGYRA-YWIQKCBGSA-N | | SMILES | O=C[C@@H]([C@H]([C@@H]([C@@H](C(OCC=C)=O)O)O)O)O |
| | D-Glucuronic acid 2-propen-1-yl ester Usage And Synthesis |
| Chemical Properties | White to Off-White Solid | | Uses | D-Glucuronic acid 2-propen-1-yl ester is used in efficient synthesis of 1β-O-acyl glucuronides via regioselective acylation of allyl or benzyl D-glucuronate. |
| | D-Glucuronic acid 2-propen-1-yl ester Preparation Products And Raw materials |
|