| Company Name: |
Zhuhai Anzhe Biotechnology Co,Ltd.
|
| Tel: |
13169972583 |
| Email: |
513211116@qq.com |
| Products Intro: |
Product Name:1-(4-hydroxy-2,6-dimethoxyphenyl)-4-(pyrrolidin-1-yl)butan-1-one
CAS:79967-07-0
Purity:95%HPLC Package:25mg;50mg;100mg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Buflomedil impurity B
CAS:79967-07-0
|
| Company Name: |
Pharma Affiliates
|
| Tel: |
172-5066494 |
| Email: |
@pharmaffiliates.com |
| Products Intro: |
Product Name:P-DEMETHYLBUFLOMEDIL
CAS:79967-07-0
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Product Name:Buflomedil impurity B
CAS:79967-07-0
|
|
| | P-DEMETHYLBUFLOMEDIL Basic information |
| Product Name: | P-DEMETHYLBUFLOMEDIL | | Synonyms: | P-DEMETHYLBUFLOMEDIL;1-(4-Hydroxy-2,6-dimethoxyphenyl)-4-(1-pyrrolidinyl)-1-butanone;1-Butanone, 1-(4-hydroxy-2,6-dimethoxyphenyl)-4-(1-pyrrolidinyl)-;Buflomedil EP Impurity B;1-(4-Hydroxy-2,6-dimethoxyphenyl)-4-(pyrrolidin-1-yl)butan-1-one | | CAS: | 79967-07-0 | | MF: | C16H23NO4 | | MW: | 293.36 | | EINECS: | | | Product Categories: | | | Mol File: | 79967-07-0.mol |  |
| | P-DEMETHYLBUFLOMEDIL Chemical Properties |
| storage temp. | 2-8°C | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C16H23NO4/c1-20-14-10-12(18)11-15(21-2)16(14)13(19)6-5-9-17-7-3-4-8-17/h10-11,18H,3-9H2,1-2H3 | | InChIKey | BJXQAMLBAONSIX-UHFFFAOYSA-N | | SMILES | N2(CCCC2)CCCC(=O)c1c(cc(cc1OC)O)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | P-DEMETHYLBUFLOMEDIL Usage And Synthesis |
| Uses | 1-(4-Hydroxy-2,6-dimethoxyphenyl)-4-(1-pyrrolidinyl)-1-Butanone is a derivative of buflomedil(55837-25-7). Buflomedil is used as an vasodilator. |
| | P-DEMETHYLBUFLOMEDIL Preparation Products And Raw materials |
|