Guanidine,(2-methyl-5-nitrophenyl) manufacturers
|
| | Guanidine,(2-methyl-5-nitrophenyl) Basic information |
| Product Name: | Guanidine,(2-methyl-5-nitrophenyl) | | Synonyms: | Guanidine,(2-methyl-5-nitrophenyl);2-Methyl-5-nitrophenylguanidine;N-(2-Methyl-5-nitrophenyl)guanidine;Guanidine, N-(2-methyl-5-nitrophenyl)-;(2-methyl-5-nitrophenyl)nitrate;Imatinib Impurity 71;Imatinib Impurity 45;2-(2-methyl-5-nitrophenyl)guanidine | | CAS: | 152460-07-6 | | MF: | C8H10N4O2 | | MW: | 194.19 | | EINECS: | | | Product Categories: | | | Mol File: | 152460-07-6.mol |  |
| | Guanidine,(2-methyl-5-nitrophenyl) Chemical Properties |
| Melting point | 216-218 °C | | Boiling point | 326.4±52.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | pka | 9.73±0.70(Predicted) | | InChI | InChI=1S/C8H10N4O2/c1-5-2-3-6(12(13)14)4-7(5)11-8(9)10/h2-4H,1H3,(H4,9,10,11) | | InChIKey | LAZBONZCMJREIQ-UHFFFAOYSA-N | | SMILES | N(C1=CC([N+]([O-])=O)=CC=C1C)C(=N)N |
| | Guanidine,(2-methyl-5-nitrophenyl) Usage And Synthesis |
| | Guanidine,(2-methyl-5-nitrophenyl) Preparation Products And Raw materials |
|