Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate manufacturers
|
| | Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate Basic information |
| Product Name: | Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate | | Synonyms: | Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate;Methyl 4-amino-2-anilino-3-fluoro-5-nitrobenzoate;Benzoicacid, 4-aMino-3-fluoro-5-nitro-2-(phenylaMino)-, Methyl ester;4-Amino-3-fluoro-5-nitro-2-phenylaminobenzoic acid methyl ester;CDS-5016;Benzoic acid, 4-amino-3-fluoro-5-nitro-2-(phenylamino)-, methyl ester (9CI, ACI);4-amino-3-fluoro-5-nitro-2-(phenylamino)-Benzoic acid methyl ester (9CI ACI);4-Ami-3-fluoro-5-nitro-2-phenylamibenzoic acid methyl ester | | CAS: | 606093-58-7 | | MF: | C14H12FN3O4 | | MW: | 305.26 | | EINECS: | | | Product Categories: | | | Mol File: | 606093-58-7.mol |  |
| | Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate Chemical Properties |
| Boiling point | 475.2±45.0 °C(Predicted) | | density | 1.441±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | -4.00±0.25(Predicted) | | InChI | InChI=1S/C14H12FN3O4/c1-22-14(19)9-7-10(18(20)21)12(16)11(15)13(9)17-8-5-3-2-4-6-8/h2-7,17H,16H2,1H3 | | InChIKey | JQUIVIJMSGIEPL-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC([N+]([O-])=O)=C(N)C(F)=C1NC1=CC=CC=C1 |
| | Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate Usage And Synthesis |
| | Methyl 4-Amino-3-Fluoro-5-Nitro-2-(Phenylamino)Benzoate Preparation Products And Raw materials |
|