|
|
| | 2,6-Diethyl-4-methylaniline Basic information |
| Product Name: | 2,6-Diethyl-4-methylaniline | | Synonyms: | 2,6-DIETHYL-4-METHYLANILINE;2,6-Diethyl-4-methylanilin;2,6-Diethyl-p-toluidine (NH2=1);2,6-DIETHYL-4-METHYLANILINE(DEMA),DEMA:=98.5%(CAPILLARY GC);2,6-diethyl-4-methylbenzenamine;(2,6-diethyl-4-methyl-phenyl)amine;2,6-diethyl-p-toluidine;Benzenamine,2,6-diethyl-4-methyl- | | CAS: | 24544-08-9 | | MF: | C11H17N | | MW: | 163.26 | | EINECS: | 246-307-5 | | Product Categories: | Intermediates of Dyes and Pigments;o-alkylated Anilines;Aniline Derivatives | | Mol File: | 24544-08-9.mol |  |
| | 2,6-Diethyl-4-methylaniline Chemical Properties |
| Boiling point | 113-115 °C(Press: 4.5 Torr) | | density | 0.940±0.06 g/cm3(Predicted) | | vapor pressure | 9Pa at 25℃ | | refractive index | 1.54 | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 4.56±0.10(Predicted) | | form | clear liquid | | color | Light yellow to Yellow to Orange | | Water Solubility | 570mg/L at 20℃ | | InChI | InChI=1S/C11H17N/c1-4-9-6-8(3)7-10(5-2)11(9)12/h6-7H,4-5,12H2,1-3H3 | | InChIKey | OIXUMNZGNCAOKY-UHFFFAOYSA-N | | SMILES | C1(N)=C(CC)C=C(C)C=C1CC | | LogP | 2.294 at 25℃ | | CAS DataBase Reference | 24544-08-9(CAS DataBase Reference) | | EPA Substance Registry System | Benzenamine, 2,6-diethyl-4-methyl- (24544-08-9) |
| | 2,6-Diethyl-4-methylaniline Usage And Synthesis |
| Chemical Properties | Colourless to yellowish liquid | | Uses | 2,6-Diethyl-4-methylaniline (DEMA) is used as intermediate for chemical synthesis. WWW Link |
| | 2,6-Diethyl-4-methylaniline Preparation Products And Raw materials |
|