|
|
| | 6-FLUORO-2-METHYLNICOTINIC ACID Basic information |
| Product Name: | 6-FLUORO-2-METHYLNICOTINIC ACID | | Synonyms: | 6-FLUORO-2-METHYLNICOTINIC ACID;2-Methyl-6-Fluoro-3-Nicotinicacid;6-Fluoro-2-methyl-3-pyridinecarboxylic acid;6-fluoro-2-Methylpyridine-3-carboxylic acid;3-Pyridinecarboxylic acid, 6-fluoro-2-methyl- | | CAS: | 884494-97-7 | | MF: | C7H6FNO2 | | MW: | 155.13 | | EINECS: | | | Product Categories: | Pyridine | | Mol File: | 884494-97-7.mol |  |
| | 6-FLUORO-2-METHYLNICOTINIC ACID Chemical Properties |
| Boiling point | 296.7±35.0 °C(Predicted) | | density | 1.341 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.13±0.25(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H6FNO2/c1-4-5(7(10)11)2-3-6(8)9-4/h2-3H,1H3,(H,10,11) | | InChIKey | PHENIYTVOJTIOS-UHFFFAOYSA-N | | SMILES | C1(C)=NC(F)=CC=C1C(O)=O |
| | 6-FLUORO-2-METHYLNICOTINIC ACID Usage And Synthesis |
| | 6-FLUORO-2-METHYLNICOTINIC ACID Preparation Products And Raw materials |
|