|
|
| | 1,1'-DIMETHYLFERROCENE Basic information |
| Product Name: | 1,1'-DIMETHYLFERROCENE | | Synonyms: | Dimethyl ferrocene;BIS(METHYLCYCLOPENTADIENYL)IRON;1,1'-DIMETHYLFERROCENE;1,1'-Dimethylferrocene,min.98%;1,1''-DIMETHYLFERROCENE, MIN. 98%;Einecs 215-067-3;1,1'-Dimethylferrocene ,97%;1,1'-Dimethylferrocene ,98% | | CAS: | 1291-47-0 | | MF: | C12H14Fe10* | | MW: | 214.08 | | EINECS: | 215-067-3 | | Product Categories: | ALD Precursors;Classes of Metal Compounds;Fe (Iron) Compounds;Ferrocenes;Metallocenes;Transition Metal Compounds;Industrial/Fine Chemicals | | Mol File: | 1291-47-0.mol |  |
| | 1,1'-DIMETHYLFERROCENE Chemical Properties |
| Melting point | 37-40 °C(lit.) | | Boiling point | 70-80 °C(Press: 2 Torr) | | density | 1.2349 g/cm3(Temp: 35 °C) | | Fp | 226 °F | | storage temp. | Inert atmosphere,Room Temperature | | form | crystal | | color | orange | | Water Solubility | Slightly soluble in methanol. Insoluble in water. | | Sensitive | air sensitive | | Stability: | Stable. Incompatible with strong oxidizing agents. | | InChI | InChI=1S/2C6H7.Fe/c2*1-6-4-2-3-5-6;/h2*2-5H,1H3; | | InChIKey | GJFIEPAJMYPAGC-UHFFFAOYSA-N | | SMILES | [C]1(C)[CH][CH][CH][CH]1.[C]1(C)[CH][CH][CH][CH]1.[Fe] |^1:0,2,3,4,5,6,8,9,10,11| | | CAS DataBase Reference | 1291-47-0(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids |
| | 1,1'-DIMETHYLFERROCENE Usage And Synthesis |
| Chemical Properties | solid | | Uses | It is used as a combustion control additive in fuels, antiknock agent in gasoline, and for heat stabilization in greases and plastics. It is used as a catalyst for synthesis of ammonia, polymerization. | | reaction suitability | core: iron reagent type: catalyst |
| | 1,1'-DIMETHYLFERROCENE Preparation Products And Raw materials |
|