| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847 13636370518 |
| Email: |
shyysw007@163.com |
| Products Intro: |
Product Name:DEOXYNIVALENOL-3-GLUCOSIDE
CAS:131180-21-7
Purity:50μg/mL 于乙腈 Package:1.2ml Remarks:B39081
|
| Company Name: |
Qingdao IniKem BioPharmaTech Co.,Ltd
|
| Tel: |
0532-58268781 18561687109 |
| Email: |
sales@inikem.com |
| Products Intro: |
Product Name:Deoxynivalenol 3-glucoside
CAS:131180-21-7
Purity:98% HPLC Package:100ug;500ug;1ug
|
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 13348960310 |
| Email: |
3003867561@qq.com |
| Products Intro: |
Product Name:Deoxynivalenol 3-glucoside
CAS:131180-21-7
Purity:溶液 Package:5mg；10mg；20mg；50mg；100mg；200mg
|
|
| | DEOXYNIVALENOL-3-GLUCOSIDE Basic information |
| Product Name: | DEOXYNIVALENOL-3-GLUCOSIDE | | Synonyms: | Deoxynivalenol 3-glucoside solution
;DEOXYNIVALENOL-3-GLUCOSIDE;Deoxynivalenol-3-glucoside Solution (50μg/ml in Acetonitrile Solution);Trichothec-9-en-8-one, 12,13-epoxy-3-(β-D-glucopyranosyloxy)-7,15-dihydroxy-, (3α,7α)-;Deoxynivalenol 3-β-D-Glucoside;13C21]-Deoxynivalenol-3-glucoside-10 μg/mL in ACN;Deoxynivalenol 3-glucoside in Acetonitrile;Deoxynivalenol-3-Glucoside(3-G-DON) | | CAS: | 131180-21-7 | | MF: | C21H30O11 | | MW: | 458.46 | | EINECS: | 621-635-5 | | Product Categories: | | | Mol File: | 131180-21-7.mol |  |
| | DEOXYNIVALENOL-3-GLUCOSIDE Chemical Properties |
| Fp | 6℃ | | storage temp. | -20°C | | form | Liquid | | color | Colorless to light yellow | | BRN | 5462389 | | Major Application | cleaning products
cosmetics
food and beverages
personal care | | InChIKey | PUMXWMGECQIOGB-SMSDQXDJSA-N | | SMILES | CC1=C[C@H]2O[C@@H]3[C@@H](C[C@@](C)([C@]34CO4)[C@@]2(CO)[C@H](O)C1=O)O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O | | LogP | -2.968 (est) |
| Hazard Codes | F,Xn | | Risk Statements | 11-20/21/22-36 | | Safety Statements | 16-36/37 | | RIDADR | UN 1648 3 / PGII | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | DEOXYNIVALENOL-3-GLUCOSIDE Usage And Synthesis |
| Uses | Deoxynivalenol 3-β-D-glucoside is the resulting compound of the detoxification effect of UDP-glycosyltransferase on Deoxynivalenol (D243900), which is a mycotoxin produced by plant pathogenic fungi affecting wheat and maize, among other grains. The addition of a glucose group from UDP-glucose to Deoxynivalenol inactivates the mycotoxin. High levels of this conjugated mycotoxin are a threat to humans as the mycotoxin can be released after hydrolysis. | | Definition | ChEBI: Deoxynivalenol 3-glucoside is a trichothecene. |
| | DEOXYNIVALENOL-3-GLUCOSIDE Preparation Products And Raw materials |
|