|
|
| | 3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo- Basic information |
| Product Name: | 3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo- | | Synonyms: | 2,3-Dimethyl-5-sulfo-3H-indole-3-hexanoic acid;3-(5-carboxypentyl)-2,3-dimethyl-5-sulfoindolium inner salt;IN1S1C;6-(2,3-DiMethyl-5-sulfo-3H-indol-3-yl)hexanoic acid;3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo-;6-(2,3-dimethyl-5-sulfoindol-3-yl)hexanoic acid | | CAS: | 407627-51-4 | | MF: | C16H21NO5S | | MW: | 339.41 | | EINECS: | | | Product Categories: | | | Mol File: | 407627-51-4.mol |  |
| | 3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo- Chemical Properties |
| InChI | InChI=1S/C16H21NO5S/c1-11-16(2,9-5-3-4-6-15(18)19)13-10-12(23(20,21)22)7-8-14(13)17-11/h7-8,10H,3-6,9H2,1-2H3,(H,18,19)(H,20,21,22) | | InChIKey | GHCMZZOTVCLUBS-UHFFFAOYSA-N | | SMILES | N1C2=C(C=C(S(O)(=O)=O)C=C2)C(C)(CCCCCC(O)=O)C=1C |
| | 3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo- Usage And Synthesis |
| | 3H-Indole-3-hexanoic acid, 2,3-dimethyl-5-sulfo- Preparation Products And Raw materials |
|