|
|
| | Ethyl2-bromothiophene-3-carboxylate Basic information |
| Product Name: | Ethyl2-bromothiophene-3-carboxylate | | Synonyms: | Ethyl2-bromothiophene-3-carboxylate;2-Bromo-3-thiophenecarboxylic acid ethyl ester;EA152;Th-COOEt-Br;3-Thiophenecarboxylic acid, 2-bromo-, ethyl ester;Ethyl 2-bromo-3-thiophenecarboxylate;IN1497, Ethyl 2-bromothiophene-3-carboxylate;Ethyl2-bromothiophene-4-carboxylate | | CAS: | 632325-50-9 | | MF: | C7H7BrO2S | | MW: | 235.1 | | EINECS: | | | Product Categories: | | | Mol File: | 632325-50-9.mol |  |
| | Ethyl2-bromothiophene-3-carboxylate Chemical Properties |
| Boiling point | 257.7±20.0 °C(Predicted) | | density | 1.572±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | color | Colourless to light yellow | | InChI | InChI=1S/C7H7BrO2S/c1-2-10-7(9)5-3-4-11-6(5)8/h3-4H,2H2,1H3 | | InChIKey | PDYDQPWWVZTVQD-UHFFFAOYSA-N | | SMILES | C1(Br)SC=CC=1C(OCC)=O |
| WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 10 - Combustible liquids |
| | Ethyl2-bromothiophene-3-carboxylate Usage And Synthesis |
| | Ethyl2-bromothiophene-3-carboxylate Preparation Products And Raw materials |
|