|
|
| | cis-Vitamin K1 Basic information |
| Product Name: | cis-Vitamin K1 | | Synonyms: | cis-Vitamin K1;[R-[R*,R*-(Z)]]-2-Methyl-3-(3,7,11,15-tetraMethyl-2-hexadecenyl)-1,4-
naphthalenedione;2-Methyl-3-[(2Z,7R,11R)-3,7,11,15-tetraMethyl-2-hexadecen-1-yl]-1,4-naphthalenedione;cis-VitaMin K1-d7/ Cis-Phytonadione-D7;Trans-VitaMin K1-d7/ Trans-Phytonadione-D7;cis-Vitamin K1 (Z-Phytonadione);2-methyl-3-[(Z,7R,11R)-3,7,11,15-tetramethylhexadec-2-enyl]naphthalene-1,4-dione;Phytonadione Impurity 1（cis-Vitamin K1） (Z-Phytonadione) | | CAS: | 16033-41-3 | | MF: | C31H46O2 | | MW: | 450.7 | | EINECS: | | | Product Categories: | Chiral Reagents;Intermediates & Fine Chemicals;Pharmaceuticals;Retinoids | | Mol File: | 16033-41-3.mol |  |
| | cis-Vitamin K1 Chemical Properties |
| Boiling point | 546.4±50.0 °C(Predicted) | | density | 0.963±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Oil | | color | Yellow | | Stability: | Light and Temperature sensitive | | InChIKey | MBWXNTAXLNYFJB-ODDKJFTJSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)C(C/C=C(/C)\CCC[C@H](C)CCC[C@H](C)CCCC(C)C)=C1C |
| | cis-Vitamin K1 Usage And Synthesis |
| Uses | The cis-isomer of Vitamin K1. |
| | cis-Vitamin K1 Preparation Products And Raw materials |
|