|
|
| | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride Basic information |
| Product Name: | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride | | Synonyms: | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride;Cyclopropanamine, 1-(2-pyridinyl)-, dihydrochloride;1-(Pyridin-2-yl)cyclopropanamine dihydrochloride;1-(2-Pyridinyl)cyclopropanamine dihydrochloride;cyclopropanamine dihydrochloride;Cyclopropanamine, 1-(2-pyridinyl)-, hydrochloride (1:2);1-(2-Pyridyl)cyclopropylamine DiHCl | | CAS: | 1215107-39-3 | | MF: | C8H11ClN2 | | MW: | 170.64 | | EINECS: | | | Product Categories: | | | Mol File: | 1215107-39-3.mol |  |
| | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H10N2.ClH/c9-8(4-5-8)7-3-1-2-6-10-7;/h1-3,6H,4-5,9H2;1H | | InChIKey | LJFVLTGRTLCTEZ-UHFFFAOYSA-N | | SMILES | NC1(C2N=CC=CC=2)CC1.Cl |
| | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride Usage And Synthesis |
| Uses | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride is the hydrochloride salt form of 1-(2-Pyridyl)cyclopropylamine, which can be used as a pharmaceutical intermediate compound for the preparation of nitrogen-containing heterocyclic drugs. |
| | 1-(2-Pyridyl)cyclopropylamine Dihydrochloride Preparation Products And Raw materials |
|