| Company Name: |
ANAXLABORATORIES PRIVATE LIMITED
|
| Tel: |
+91-9177075735 |
| Email: |
KIRAN.KARNATI@ANAXLAB.COM |
| Products Intro: |
Product Name:1- ( 4- ( trifluoromethoxy ) phenyl ) cyclopropane - 1 - carboxylic acid
CAS:936727-93-4
Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
Amatek Scientific Co. Ltd.
|
| Tel: |
0512-56316828 4008675858 |
| Email: |
sales@amateksci.com |
| Products Intro: |
Product Name:1-[4-(TrifluoroMethoxy)phenyl]cyclopropane-1-carboxylic acid
CAS:936727-93-4
Purity:97% HPLC Package:1g;5g;25g;100g
|
| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:1-(4-(Trifluoromethoxy)phenyl)cyclopropane-1-carboxylic acid
CAS:936727-93-4
Purity:97% Package:100mg;250mg;1g;5g Remarks:BD427317
|
|
| | 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid Basic information |
| Product Name: | 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid | | Synonyms: | 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid;1-[4-(TrifluoroMethoxy)phenyl]cyclopropane-1-carboxylic acid;Cyclopropanecarboxylic acid, 1-[4-(trifluoromethoxy)phenyl]-;1-(4-Trifluoromethoxyphenyl)-1-carboxycyclopropane;1-(4-(Trifluoromethoxy)phenyl)cyclopropane-1-carboxylic acid - [T93137] | | CAS: | 936727-93-4 | | MF: | C11H9F3O3 | | MW: | 246.18 | | EINECS: | | | Product Categories: | | | Mol File: | 936727-93-4.mol |  |
| | 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | form | powder | | color | White | | InChI | 1S/C11H9F3O3/c12-11(13,14)17-8-3-1-7(2-4-8)10(5-6-10)9(15)16/h1-4H,5-6H2,(H,15,16) | | InChIKey | WLYQHMMKMYCFAP-UHFFFAOYSA-N | | SMILES | OC(C1(C2=CC=C(C=C2)OC(F)(F)F)CC1)=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2917399590 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid Usage And Synthesis |
| | 1-(4-(trifluoromethoxy)phenyl)cyclopropanecarboxylic acid Preparation Products And Raw materials |
|