5-Ethynyl uridine manufacturers
- 5-Ethynyl uridine
-
-
2026-06-05
- CAS:69075-42-9
- Min. Order: 1g
- Purity: 98%min
- Supply Ability: 1000g
- 5-Ethynyluridine
-
- $47.00
-
2026-05-11
- CAS:69075-42-9
- Purity: 99.77%
- Supply Ability: 10g
- 5-Ethynyl uridine
-
-
2025-06-07
- CAS:69075-42-9
- Min. Order: 5g
- Purity: >95.00%
- Supply Ability: 5g
|
| | 5-Ethynyl uridine Basic information |
| Product Name: | 5-Ethynyl uridine | | Synonyms: | 5-Ethynyl uridine;1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-ethynylpy;1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-ethynylpyrimidine-2,4(1H,3H)-dione;5-ETHYNYL URIDINE; 1-((2R,3R,4S,5R)-3,4-DIHYDROXY-5-(HYDROXYMETHYL)TETRAHYDROFURAN-2-YL)-5-ETHYNYLPY;5-Ethynyluridine (5-EU);5-Ethynyl Uridine (EU);Uridine, 5-ethynyl-;5-EU | | CAS: | 69075-42-9 | | MF: | C11H12N2O6 | | MW: | 268 | | EINECS: | 500-100-4 | | Product Categories: | | | Mol File: | 69075-42-9.mol |  |
| | 5-Ethynyl uridine Chemical Properties |
| Melting point | >164oC (dec.) | | density | 1.67±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated, Sonicated) | | pka | 8.29±0.10(Predicted) | | form | Solid | | color | Off-White to Pale Beige | | Appearance | off white solid | | InChI | InChI=1S/C11H12N2O6/c1-2-5-3-13(11(18)12-9(5)17)10-8(16)7(15)6(4-14)19-10/h1,3,6-8,10,14-16H,4H2,(H,12,17,18)/t6-,7-,8-,10-/m1/s1 | | InChIKey | QCWBIPKYTBFWHH-FDDDBJFASA-N | | SMILES | OC[C@H]1O[C@@H](N2C=C(C#C)C(=O)NC2=O)[C@H](O)[C@@H]1O |
| WGK Germany | WGK 3 | | HS Code | 29335990 | | Storage Class | 11 - Combustible Solids |
| | 5-Ethynyl uridine Usage And Synthesis |
| Description | 5-Ethynyl uridine (5-EU) is an alkyne-containing metabolic labeling reagent used to detect global RNA transcription temporally and spatially in both in-vitro and in-vivo with the modified nucleotide. The alkyne handler can be used for subsequent ligation to azide-containing molecules through a highly efficient click chemistry reaction. | | Uses | 5-Ethynyluridine is used to help detect RNA synthesis in cells by its biosynthetic incorporation into newly transcribed RNA. | | Uses | This alkyne-bearing metabolic labeling reagent can be used to measure RNA synthesis in proliferating cells. Once fed to cells, this nucleoside is incorporated during active RNA synthesis and can then be detected using a copper-catalyzed click reaction with fluorescent dyes. The cells can then be analysed by fluorescence imaging, flow cytometry or high content imaging analysis. | | reaction suitability | reaction type: click chemistry | | storage | Store at -20°C |
| | 5-Ethynyl uridine Preparation Products And Raw materials |
|