- NH2-PEG8-acid
-
- $40.00
-
2026-05-11
- CAS:756526-04-2
- Purity: 99.72%
- Supply Ability: 10g
- NH2-PEG9-acid
-
- $2.00
-
2026-04-17
- CAS:756526-04-2
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | alpha-aMine-oMega-propionic acid octaethylene glycol Basic information |
| Product Name: | alpha-aMine-oMega-propionic acid octaethylene glycol | | Synonyms: | alpha-aMine-oMega-propionic acid octaethylene glycol;AMINE-PEG8-COOH;Amino-PEG8-COOH;Amino-dPEG(R)8-acid;NH2-PEG9-acid;3-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid;Amino-PEG8-acid,H2N-PEG8-COOH;4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-amino- | | CAS: | 756526-04-2 | | MF: | C19H39NO10 | | MW: | 441.51 | | EINECS: | | | Product Categories: | peg | | Mol File: | 756526-04-2.mol |  |
| | alpha-aMine-oMega-propionic acid octaethylene glycol Chemical Properties |
| Boiling point | 547.1±50.0 °C(Predicted) | | density | 1.128±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in Water, DMSO, DCM, DMF | | pka | 4.28±0.10(Predicted) | | form | solid or viscous liquid | | color | White to light yellow | | InChI | InChI=1S/C19H39NO10/c20-2-4-24-6-8-26-10-12-28-14-16-30-18-17-29-15-13-27-11-9-25-7-5-23-3-1-19(21)22/h1-18,20H2,(H,21,22) | | InChIKey | YLKOHZCQTVYVDB-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
| WGK Germany | WGK 3 | | HS Code | 2942000090 | | Storage Class | 11 - Combustible Solids |
| | alpha-aMine-oMega-propionic acid octaethylene glycol Usage And Synthesis |
| Description | Amino-PEG8-acid is a water soluble PEG linker consisting of an amino group (NH2) with a terminal carboxylic acid. The amine group is reactive with activated NHS esters, carbonyls (ketone, aldehyde) etc. | | Uses | 1-Amino-3,6,9,12,15,18,21,24-octaoxaheptacosan-27-oic Acid is used in targeted drug delivery as conjugate with carbon nanotubes. It is also used as linker for enzyme immobilization in optimization of bio-nano interface to enhance enzyme catalytic efficiency. | | reaction suitability | reagent type: cross-linking reagent
reactivity: carboxyl reactive | | IC 50 | Non-cleavable Linker; PEGs |
| | alpha-aMine-oMega-propionic acid octaethylene glycol Preparation Products And Raw materials |
|