|
|
| | 2-BROMO-4-FLUORO-5-NITROPHENOL Basic information |
| | 2-BROMO-4-FLUORO-5-NITROPHENOL Chemical Properties |
| Melting point | 124-127℃ | | Boiling point | 302.4±42.0 °C(Predicted) | | density | 1.965±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 6.51±0.24(Predicted) | | form | Powder | | color | Brown | | InChI | InChI=1S/C6H3BrFNO3/c7-3-1-4(8)5(9(11)12)2-6(3)10/h1-2,10H | | InChIKey | NVNFKCCUJKPLLT-UHFFFAOYSA-N | | SMILES | C1(O)=CC([N+]([O-])=O)=C(F)C=C1Br | | CAS DataBase Reference | 84478-87-5(CAS DataBase Reference) |
| Hazard Codes | Xi | | RIDADR | UN2811 | | HazardClass | 6.1 | | HS Code | 2908990000 |
| | 2-BROMO-4-FLUORO-5-NITROPHENOL Usage And Synthesis |
| Uses | 2-Bromo-4-fluoro-5-nitrophenol is a polysubstituted phenol derivative that can be used in the synthesis of isoindolinone and thienopyrimidine dione compounds. |
| | 2-BROMO-4-FLUORO-5-NITROPHENOL Preparation Products And Raw materials |
|