|
|
| | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate Basic information |
| Product Name: | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate | | Synonyms: | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate;4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate;2-Nitro-4-(3-chloro-propoxy)-5-methoxy-benzoic acid methyl ester;Benzoic acid, 4-(3-chloropropoxy)-5-methoxy-2-nitro-, methyl ester | | CAS: | 214470-57-2 | | MF: | C12H14ClNO6 | | MW: | 303.7 | | EINECS: | | | Product Categories: | | | Mol File: | 214470-57-2.mol |  |
| | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate Chemical Properties |
| Melting point | 54-56 °C(Solv: ethyl acetate (141-78-6); ligroine (8032-32-4)) | | Boiling point | 457.3±40.0 °C(Predicted) | | density | 1.311±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C12H14ClNO6/c1-18-10-6-8(12(15)19-2)9(14(16)17)7-11(10)20-5-3-4-13/h6-7H,3-5H2,1-2H3 | | InChIKey | UMBVDMOFTQTPPF-UHFFFAOYSA-N | | SMILES | C(OC)(=O)C1=CC(OC)=C(OCCCCl)C=C1[N+]([O-])=O |
| | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate Usage And Synthesis |
| Uses | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate is a highly functionalized nitrobenzene-based fine chemical intermediate, mainly used in pharmaceutical research and development. | | structure and hydrogen bonding |
The compound Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate, C12H14ClNO6, contains two crystallographically independent mol-ecules, in which the benzene rings are oriented at a dihedral angle of 9.12(3)°. Weak inter-molecular C—HO hydrogen bonds in the crystal structure link the mol-ecules into a three-dimensional network.
|
| | Methyl 4-(3-chloropropoxy)-5-Methoxy-2-nitrobenzoate Preparation Products And Raw materials |
|