|
|
| | ETHYL MESITYLACETATE Basic information |
| Product Name: | ETHYL MESITYLACETATE | | Synonyms: | 2-(2,4,6-trimethylphenyl)acetic acid ethyl ester;ethyl 2-(2,4,6-trimethylphenyl)acetate;ethyl 2-(2,4,6-trimethylphenyl)ethanoate;Benzeneacetic acid, 2,4,6-triMethyl-, ethyl ester;ETHYL 2,4,6-TRIMETHYLPHENYL ACETATE;ETHYL MESITYLACETATE;Ethyl 2,4,6-trimethylphenylacetate~Mesitylacetic acid ethyl ester;mesitylacetic acid ethyl ester | | CAS: | 5460-08-2 | | MF: | C13H18O2 | | MW: | 206.28 | | EINECS: | | | Product Categories: | | | Mol File: | 5460-08-2.mol |  |
| | ETHYL MESITYLACETATE Chemical Properties |
| Boiling point | 135-140°C 9mm | | density | 1,034 g/cm3 | | refractive index | 1.5050 | | Fp | 135-140°C/9mm | | storage temp. | 2-30°C | | form | liquid | | color | Clear, colourless | | BRN | 2105791 | | InChI | 1S/C13H18O2/c1-5-15-13(14)8-12-10(3)6-9(2)7-11(12)4/h6-7H,5,8H2,1-4H3 | | InChIKey | OFZZPFNYAMIBNU-UHFFFAOYSA-N | | SMILES | CCOC(CC1=C(C)C=C(C)C=C1C)=O | | CAS DataBase Reference | 5460-08-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 2916399090 | | Storage Class | 10 - Combustible liquids |
| Provider | Language |
|
ALFA
| English |
| | ETHYL MESITYLACETATE Usage And Synthesis |
| | ETHYL MESITYLACETATE Preparation Products And Raw materials |
|