| Company Name: |
3B Pharmachem (Wuhan) International Co.,Ltd.
|
| Tel: |
18930552037 |
| Email: |
3bsc@sina.com |
| Products Intro: |
Product Name:DCB;[(3-Chlorophenyl)Methylene]hydrazone-3-chlorobenzaldehyde
CAS:6971-97-7
Purity:99% HPLC Package:1Mg ; 5Mg;10Mg ;100Mg;250Mg ;500Mg ;1g;2.5g ;5g ;10g
|
| Company Name: |
EMMX Biotechnology LLC
|
| Tel: |
888-539-0666 |
| Email: |
info@emmx.com |
| Products Intro: |
Product Name:DCB
CAS:6971-97-7
Purity:98% HPLC Package:5mg;10mg;25mg;50mg;100mg;250mg;500mg;1g
|
DCB manufacturers
- DCB
-
- $88.00
-
2026-07-08
- CAS:6971-97-7
- Purity: 99.90%
- Supply Ability: 10g
|
| Product Name: | DCB | | Synonyms: | NSC 67224;[(3-CHLOROPHENYL)METHYLENE]HYDRAZONE-3-CHLOROBENZALDEHYDE;3,3'-DICHLOROBENZALDAZINE;3,3μ-Dichlorobenzaldazine, NSC 67224;1,1'-(Azinobismethylidyne)bis(3-chlorobenzene);1,2-Bis(3-chlorobenzylidene)hydrazine;3,3'-Dichlorobenzylideneazine;α,α'-Azinobis(m-chlorotoluene) | | CAS: | 6971-97-7 | | MF: | C14H10Cl2N2 | | MW: | 277.15 | | EINECS: | | | Product Categories: | Glutamate receptor | | Mol File: | 6971-97-7.mol |  |
| Melting point | 40 °C | | Boiling point | 387.8±42.0 °C(Predicted) | | density | 1.21±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ~6.8 mg/mL | | pka | 5.84±0.50(Predicted) | | form | solid | | color | yellow | | InChI | 1S/C14H10Cl2N2/c15-13-5-1-3-11(7-13)9-17-18-10-12-4-2-6-14(16)8-12/h1-10H/b17-9+,18-10+ | | InChIKey | XMOVWXSCYLINBJ-BEQMOXJMSA-N | | SMILES | Clc1cccc(\C=N\N=C\c2cccc(Cl)c2)c1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-37/38-41-43-50/53 | | Safety Statements | 26-36/37-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Dam. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| Uses | DCB is an allosteric ligand for mGluR-5 (1). Regulates glutamate concentration however may induce neuronal damage through cerebral ischemia (2). | | Biological Activity | Allosteric ligand for the metabotropic glutamate receptor mGlu 5 ; displays neutral modulation. Does not affect agonist-stimulated mGlu 5 responses, but blocks regulation of the receptor by other allosteric modulators such as DFB ([(3-Fluorophenyl)methylene]hydrazone-3-fluorobenzaldehyde ) and DMeOB ([(3-Methoxyphenyl)methylene]hydrazone-3-methoxybenzaldehyde ). | | IC 50 | mGluR 5 |
| | DCB Preparation Products And Raw materials |
|