|
|
| | Fmoc-PEG4-NHS ester Basic information |
| Product Name: | Fmoc-PEG4-NHS ester | | Synonyms: | Fmoc-PEG4-NHS ester;FmocNH-PEG4-NHS?ester;Fmoc-N-amido-dPEG (R)4-NHS ester;FmocNH-PEG4-CH2CH2COONHS;α-(fmoc-amino)-omega-(succinimidyl propionate) tetra(ethylene glycol);FmocNH-PEG4-CH2CH2COONHS/5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 17-(2,5-dioxo-1-pyrrolidinyl) 1-(9H-fluoren-9-ylmethyl) ester;(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoate;5,8,11,14-Tetraoxa-2-azaheptadecanedioic acid, 17-(2,5-dioxo-1-pyrrolidinyl) 1-(9H-fluoren-9-ylmethyl) ester | | CAS: | 1314378-14-7 | | MF: | C30H36N2O10 | | MW: | 584.61 | | EINECS: | | | Product Categories: | | | Mol File: | 1314378-14-7.mol |  |
| | Fmoc-PEG4-NHS ester Chemical Properties |
| density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Soluble in DMSO, DMF, DCM | | pka | 11.60±0.46(Predicted) | | form | Viscous Liquid | | color | Colorless to light yellow | | InChIKey | NMCTTZZPHFQEQB-UHFFFAOYSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NCCOCCOCCOCCOCCC(ON1C(=O)CCC1=O)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-PEG4-NHS ester Usage And Synthesis |
| Description | Fmoc-PEG4-NHS ester is a PEG linker containing an Fmoc-protected amine and an NHS ester. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. | | Uses | Alpha-(fmoc-amino)-omega-(succinimidyl propionate) tetra(ethylene glycol) | | reaction suitability | reaction type: Pegylations
reagent type: cross-linking reagent | | IC 50 | PEGs; Alkyl/ether |
| | Fmoc-PEG4-NHS ester Preparation Products And Raw materials |
|