| Company Name: |
Hangzhou Huarong Pharm Co., Ltd. |
| Tel: |
571-86758373 +8613588754946 |
| Email: |
sales@huarongpharm.com |
| Products Intro: |
Product Name:(2S,3R,4R,5S,6R)-2-(4-chloro-3-(4-(((R)-tetrahydrofuran-3-yl) oxy)benzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5- triol CAS:864070-43-9 Purity:0.99 Package:10MG,50MG,100MG,1G
|
|
|
|
|
|
| | Empagliflozin (R)-Isomer Basic information |
| Product Name: | Empagliflozin (R)-Isomer | | Synonyms: | Empagliflozin (R)-Isomer;Impurities of Empagliflozin;Empagliflozin-2;Jardiance Impurity;Empagliflozin 3-Epimer;Empagliflozin impurity 2/Empagliflozin 3-Epimer/(2S,3R,4R,5S,6R)-2-(4-chloro-3-(4-(((R)-tetrahydrofuran-3-yl)oxy)benzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol;D-Glucitol, 1,5-anhydro-1-C-[4-chloro-3-[[4-[[(3R)-tetrahydro-3-furanyl]oxy]phenyl]methyl]phenyl]-, (1S)-;3-Epi empagliflozin Impurity | | CAS: | 864070-43-9 | | MF: | C23H27ClO7 | | MW: | 450.91 | | EINECS: | | | Product Categories: | | | Mol File: | 864070-43-9.mol |  |
| | Empagliflozin (R)-Isomer Chemical Properties |
| Boiling point | 664.5±55.0 °C(Predicted) | | density | 1.398±0.06 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 13.23±0.70(Predicted) | | color | White to Off-White | | InChIKey | OBWASQILIWPZMG-VQDFNRIVNA-N | | SMILES | O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1C1=CC=C(Cl)C(CC2=CC=C(O[C@@H]3CCOC3)C=C2)=C1 |&1:1,4,6,8,10,23,r| |
| | Empagliflozin (R)-Isomer Usage And Synthesis |
| Uses | 3’’’-Epi-Empagliflozin is an impurity of Empagliflozin (E521510) which is a novel, potent and selective SGLT-2 inhibitor, improves glycaemic control and features of metabolic syndrome in diabetic rats. |
| | Empagliflozin (R)-Isomer Preparation Products And Raw materials |
|