DMAC-TRZ manufacturers
- DMAc-TRZ
-
- $120.00
-
2025-04-15
- CAS:1628752-98-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
- DMAC-TRZ
-
-
2025-04-04
- CAS:1628752-98-6
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
|
| | DMAC-TRZ Basic information |
| Product Name: | DMAC-TRZ | | Synonyms: | DMAC-TRZ;Acridine, 10-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-9,10-dihydro-9,9-dimethyl-;10-(4-(4,6-Diphenyl-1,3,5-triazol-2-yl)phenyl)-9,9-dimethyl-9,10-dihydroacridine;10-(4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl)-9,9-dimethyl-9,10-dihydroacridine | | CAS: | 1628752-98-6 | | MF: | C36H28N4 | | MW: | 516.63 | | EINECS: | | | Product Categories: | | | Mol File: | 1628752-98-6.mol |  |
| | DMAC-TRZ Chemical Properties |
| Boiling point | 716.3±70.0 °C(Predicted) | | density | 1.186±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | solubility | toluene: soluble | | pka | 0.93±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChIKey | IVXBGKPGZOETEW-UHFFFAOYSA-N | | SMILES | C1=C2C(N(C3=CC=C(C4=NC(C5=CC=CC=C5)=NC(C5=CC=CC=C5)=N4)C=C3)C3=C(C2(C)C)C=CC=C3)=CC=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | DMAC-TRZ Usage And Synthesis |
| Uses | DMAC-TRZ can be used in R&D studies such as organic light-emitting diodes (OLEDs), organic photovoltaic (OPV) devices, organic field-effect transistors (OFETs) and Dye-sensitized solar cells (DSSCs). DMAC-TRZ has energy levels that align well with other materials commonly used in electronic devices. This property allows for efficient charge injection, extraction and transport across different layers, which contributes to improved device operation and performance. Sublimed high purity material used as TADF Blue-green Dopant, with EQE of 26.5%. |
| | DMAC-TRZ Preparation Products And Raw materials |
|