|
|
| | 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Basic information |
| Product Name: | 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | | Synonyms: | 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol;Phenol, 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-;3-Chloro-4-hydroxy-2-methylphenylboronic Acid Pinacol Ester;-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol | | CAS: | 1799612-10-4 | | MF: | C13H18BClO3 | | MW: | 268.54 | | EINECS: | | | Product Categories: | | | Mol File: | 1799612-10-4.mol |  |
| | 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Chemical Properties |
| Boiling point | 369.2±42.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 8.30±0.40(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C13H18BClO3/c1-8-9(6-7-10(16)11(8)15)14-17-12(2,3)13(4,5)18-14/h6-7,16H,1-5H3 | | InChIKey | BTFZTLFXZKHQLJ-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(B2OC(C)(C)C(C)(C)O2)C(C)=C1Cl |
| | 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Usage And Synthesis |
| | 2-chloro-3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol Preparation Products And Raw materials |
|