| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
0755-66853366 13670046396 |
| Email: |
orders@qcsrm.com |
| Products Intro: |
Product Name:Arbidol Impurity 31
CAS:151455-32-2
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
Arbitol Sulfone manufacturers
- Arbidol Sulfone
-
-
2026-03-12
- CAS:151455-32-2
- Min. Order: 10mg
- Purity: 0.98
- Supply Ability: 10g
|
| | Arbitol Sulfone Basic information |
| Product Name: | Arbitol Sulfone | | Synonyms: | Arbitol Sulfone;Arbidol Sulfone;ethyl 2-(benzenesulfonylmethyl)-6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate;Arbidol Impurity 35;Abidol impurity Z6;Arbidol Impurity 31;Impurities in Arbidol907;1H-Indole-3-carboxylic acid, 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-[(phenylsulfonyl)methyl]-, ethyl ester | | CAS: | 151455-32-2 | | MF: | C22H25BrN2O5S | | MW: | 509.41 | | EINECS: | | | Product Categories: | | | Mol File: | 151455-32-2.mol |  |
| | Arbitol Sulfone Chemical Properties |
| Boiling point | 668.2±55.0 °C(Predicted) | | density | 1.44±0.1 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 5.92±0.50(Predicted) | | form | Solid | | color | Dark Brown | | Stability: | Light Sensitive | | InChI | InChI=1S/C22H25BrN2O5S/c1-5-30-22(27)20-18(13-31(28,29)14-9-7-6-8-10-14)25(4)17-11-16(23)21(26)15(19(17)20)12-24(2)3/h6-11,26H,5,12-13H2,1-4H3 | | InChIKey | JFYQRVBFTIWYAP-UHFFFAOYSA-N | | SMILES | N1(C)C2=C(C(CN(C)C)=C(O)C(Br)=C2)C(C(OCC)=O)=C1CS(C1=CC=CC=C1)(=O)=O |
| | Arbitol Sulfone Usage And Synthesis |
| Uses | Arbidol Sulfone is a metabolite of Arbidol (A766000) which is a medicinal agent for treating viral infections. |
| | Arbitol Sulfone Preparation Products And Raw materials |
|