| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Tel: |
021-021-021-67601398-809-809-809 15221380277 |
| Email: |
marketing_china@spectrumchemical.com |
| Products Intro: |
Product Name:Carbol Fuchsin Solution, Kinyoun
Package:500ML Remarks:LC12880
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:Carbol-Fuchsin solution according to Kinyoun
|
| Company Name: |
Riedel-de Haen AG
|
| Tel: |
800 558-9160 |
| Email: |
|
| Products Intro: |
Purity:for microscopy
|
| Company Name: |
Lab Express
|
| Tel: |
973 227 0023 |
| Email: |
sales@labexpress.com |
| Products Intro: |
|
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
| Products Intro: |
|
|
| | KINYOUN'S SOLUTION Basic information |
| Product Name: | KINYOUN'S SOLUTION | | Synonyms: | AFB STAIN;CARBOL-FUCHSIN ACCORDING TO KINYOUN;CARBOL FUCHSIN SOLUTION, KINYOUN;FUCHSIN, CARBOL;KINYOUN'S CARBOL-FUCHSIN;KINYOUN'S SOLUTION;Carbol-Fuchsin solution according to Kinyoun | | CAS: | | | MF: | C21H21N3 | | MW: | 315.41 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | KINYOUN'S SOLUTION Chemical Properties |
| density | 0.99 g/mL at 20 °C | | Fp | 43 °C | | storage temp. | room temp | | form | liquid | | color | red to very dark red | | ε(extinction coefficient) | 77 at 546nm in 50% ethanol | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C21H21N3/c1-13-11-16(5-9-19(13)23)21(15-3-7-18(22)8-4-15)17-6-10-20(24)14(2)12-17/h3-12,22H,23-24H2,1-2H3 | | InChIKey | IMOKRVRFBCWWGH-UHFFFAOYSA-N | | SMILES | NC1=CC=C(C(C2=CC=C(N)C=C2)=C(C=C3)C=CC3=[NH2+])C=C1.[Cl-] |
| Hazard Codes | C | | Risk Statements | 10-20/21/22-34-40-68 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2924 3/PG 3 | | WGK Germany | 3 | | F | 8 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 3
Carc. 2
Eye Dam. 1
Flam. Liq. 3
Muta. 2
Skin Corr. 1B |
| | KINYOUN'S SOLUTION Usage And Synthesis |
| Uses | - Kinyoun's carbol-fuchsin is intended for use to stain paraffin sections of a formaldehyde-fixed specimen containing tubercle bacilli, and for the demonstration of tuberculosis bacteria (Mycobacterium tuberculosis).
- It is also applicable for other organisms th at retain the dye after immersion in acidified 70% alcohol.
- It has been used to develop a staining technique for detecting microsporidial spores in fecal specimens.
|
| | KINYOUN'S SOLUTION Preparation Products And Raw materials |
|